C11H18O2S — CID 15082637
ethyl 3,4,6-trimethyl-2,5-dihydrothiopyran-6-carboxylate (PubChem CID 15082637) has the molecular formula C11H18O2S and a molecular weight of 214.33 g/mol. Its IUPAC name is ethyl 3,4,6-trimethyl-2,5-dihydrothiopyran-6-carboxylate.
| Compound Name | ethyl 3,4,6-trimethyl-2,5-dihydrothiopyran-6-carboxylate |
|---|---|
| PubChem CID | 15082637 |
| Molecular Formula | C11H18O2S |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | ethyl 3,4,6-trimethyl-2,5-dihydrothiopyran-6-carboxylate |
| SMILES | CCOC(=O)C1(C)CC(C)=C(C)CS1 |
| InChI | InChI=1S/C11H18O2S/c1-5-13-10(12)11(4)6-8(2)9(3)7-14-11/h5-7H2,1-4H3 |
| InChIKey | QIVHLILYRIUJRK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|