C13H20O5S — CID 13451207
diethyl 3,4-dimethyl-1-oxo-2,5-dihydrothiopyran-6,6-dicarboxylate (PubChem CID 13451207) has the molecular formula C13H20O5S and a molecular weight of 288.37 g/mol. Its IUPAC name is diethyl 3,4-dimethyl-1-oxo-2,5-dihydrothiopyran-6,6-dicarboxylate.
| Compound Name | diethyl 3,4-dimethyl-1-oxo-2,5-dihydrothiopyran-6,6-dicarboxylate |
|---|---|
| PubChem CID | 13451207 |
| Molecular Formula | C13H20O5S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | diethyl 3,4-dimethyl-1-oxo-2,5-dihydrothiopyran-6,6-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(C)=C(C)CS1=O |
| InChI | InChI=1S/C13H20O5S/c1-5-17-11(14)13(12(15)18-6-2)7-9(3)10(4)8-19(13)16/h5-8H2,1-4H3 |
| InChIKey | UGBBDUDMSMUMCW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|