C14H18O4S — CID 57333026
diethyl (3aS,7aS)-4,7-dihydro-1-benzothiophene-3a,7a-dicarboxylate (PubChem CID 57333026) has the molecular formula C14H18O4S and a molecular weight of 282.36 g/mol. Its IUPAC name is diethyl (3aS,7aS)-4,7-dihydro-1-benzothiophene-3a,7a-dicarboxylate.
| Compound Name | diethyl (3aS,7aS)-4,7-dihydro-1-benzothiophene-3a,7a-dicarboxylate |
|---|---|
| PubChem CID | 57333026 |
| Molecular Formula | C14H18O4S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | diethyl (3aS,7aS)-4,7-dihydro-1-benzothiophene-3a,7a-dicarboxylate |
| SMILES | CCOC(=O)[C@]12C=CS[C@@]1(C(=O)OCC)CC=CC2 |
| InChI | InChI=1S/C14H18O4S/c1-3-17-11(15)13-7-5-6-8-14(13,19-10-9-13)12(16)18-4-2/h5-6,9-10H,3-4,7-8H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | VAKOWRPNPAVENA-UONOGXRCSA-N |
| XLogP | 2.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|