C11H16O2S — CID 10036118
ethyl (3aS,4R,7aS)-1,3,3a,4,5,7a-hexahydro-2-benzothiophene-4-carboxylate (PubChem CID 10036118) has the molecular formula C11H16O2S and a molecular weight of 212.31 g/mol. Its IUPAC name is ethyl (3aS,4R,7aS)-1,3,3a,4,5,7a-hexahydro-2-benzothiophene-4-carboxylate.
| Compound Name | ethyl (3aS,4R,7aS)-1,3,3a,4,5,7a-hexahydro-2-benzothiophene-4-carboxylate |
|---|---|
| PubChem CID | 10036118 |
| Molecular Formula | C11H16O2S |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | ethyl (3aS,4R,7aS)-1,3,3a,4,5,7a-hexahydro-2-benzothiophene-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC=C[C@@H]2CSC[C@H]21 |
| InChI | InChI=1S/C11H16O2S/c1-2-13-11(12)9-5-3-4-8-6-14-7-10(8)9/h3-4,8-10H,2,5-7H2,1H3/t8-,9-,10-/m1/s1 |
| InChIKey | RNVWYQUEKSNLHT-OPRDCNLKSA-N |
| XLogP | 2.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|