C12H18O2S — CID 15744644
ethyl (3aS,5R,7aS)-5-methyl-1,3,3a,4,5,7a-hexahydro-2-benzothiophene-4-carboxylate (PubChem CID 15744644) has the molecular formula C12H18O2S and a molecular weight of 226.34 g/mol. Its IUPAC name is ethyl (3aS,5R,7aS)-5-methyl-1,3,3a,4,5,7a-hexahydro-2-benzothiophene-4-carboxylate.
| Compound Name | ethyl (3aS,5R,7aS)-5-methyl-1,3,3a,4,5,7a-hexahydro-2-benzothiophene-4-carboxylate |
|---|---|
| PubChem CID | 15744644 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | ethyl (3aS,5R,7aS)-5-methyl-1,3,3a,4,5,7a-hexahydro-2-benzothiophene-4-carboxylate |
| SMILES | CCOC(=O)C1[C@H](C)C=C[C@@H]2CSC[C@@H]12 |
| InChI | InChI=1S/C12H18O2S/c1-3-14-12(13)11-8(2)4-5-9-6-15-7-10(9)11/h4-5,8-11H,3,6-7H2,1-2H3/t8-,9-,10-,11?/m1/s1 |
| InChIKey | QHAMMKMFBATEFP-QHPFDFDXSA-N |
| XLogP | 2.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|