C23H24Cl2N2O7 — CID 70400140
[(2S,5S)-2-[(E,4S)-4-(2,4-dichlorophenoxy)-3-oxopent-1-enyl]-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate (PubChem CID 70400140) has the molecular formula C23H24Cl2N2O7 and a molecular weight of 511.36 g/mol. Its IUPAC name is [(2S,5S)-2-[(E,4S)-4-(2,4-dichlorophenoxy)-3-oxopent-1-enyl]-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate.
| Compound Name | [(2S,5S)-2-[(E,4S)-4-(2,4-dichlorophenoxy)-3-oxopent-1-enyl]-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 70400140 |
| Molecular Formula | C23H24Cl2N2O7 |
| Molecular Weight | 511.36 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | [(2S,5S)-2-[(E,4S)-4-(2,4-dichlorophenoxy)-3-oxopent-1-enyl]-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate |
| SMILES | CCc1cn([C@@H]2CC(OC(C)=O)[C@H](/C=C/C(=O)[C@H](C)Oc3ccc(Cl)cc3Cl)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H24Cl2N2O7/c1-4-14-11-27(23(31)26-22(14)30)21-10-20(33-13(3)28)19(34-21)8-6-17(29)12(2)32-18-7-5-15(24)9-16(18)25/h5-9,11-12,19-21H,4,10H2,1-3H3,(H,26,30,31)/b8-6+/t12-,19-,20?,21-/m0/s1 |
| InChIKey | PUBWYPUYVQIOIS-SUTJWYJCSA-N |
| XLogP | 3.22 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|