C26H37NO3 — CID 70400581
(8'S,13'S,14'S)-16'-(dimethylaminomethylidene)-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,6,7,8,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene]-17'-one (PubChem CID 70400581) has the molecular formula C26H37NO3 and a molecular weight of 411.59 g/mol. Its IUPAC name is (8'S,13'S,14'S)-16'-(dimethylaminomethylidene)-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,6,7,8,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene]-17'-one.
| Compound Name | (8'S,13'S,14'S)-16'-(dimethylaminomethylidene)-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,6,7,8,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene]-17'-one |
|---|---|
| PubChem CID | 70400581 |
| Molecular Formula | C26H37NO3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | (8'S,13'S,14'S)-16'-(dimethylaminomethylidene)-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,6,7,8,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene]-17'-one |
| SMILES | CN(C)C=C1C[C@H]2[C@@H]3CCC4=C(CCC5(C4)OCC(C)(C)CO5)C3=CC[C@]2(C)C1=O |
| InChI | InChI=1S/C26H37NO3/c1-24(2)15-29-26(30-16-24)11-9-19-17(13-26)6-7-21-20(19)8-10-25(3)22(21)12-18(23(25)28)14-27(4)5/h8,14,21-22H,6-7,9-13,15-16H2,1-5H3/t21-,22+,25+/m1/s1 |
| InChIKey | WHOZTLBBGPWURK-SLSDLSHTSA-N |
| XLogP | 5.02 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|