C23H32O3 — CID 134267756
(17'S)-17'-(1-methoxyethenyl)-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene] (PubChem CID 134267756) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is (17'S)-17'-(1-methoxyethenyl)-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene].
| Compound Name | (17'S)-17'-(1-methoxyethenyl)-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene] |
|---|---|
| PubChem CID | 134267756 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (17'S)-17'-(1-methoxyethenyl)-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene] |
| SMILES | C=C(OC)[C@H]1CCC2C3CCC4=C(CCC5(C4)OCCO5)C3=CCC21C |
| InChI | InChI=1S/C23H32O3/c1-15(24-3)20-6-7-21-19-5-4-16-14-23(25-12-13-26-23)11-9-17(16)18(19)8-10-22(20,21)2/h8,19-21H,1,4-7,9-14H2,2-3H3/t19?,20-,21?,22?/m1/s1 |
| InChIKey | HBRQRIUSMGAUSP-HARJDGEMSA-N |
| XLogP | 5.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|