C27H40O3 — CID 67832544
(1'S,2'S,4'S,6'R,7'S)-6'-hexoxy-7'-methylspiro[1,3-dioxolane-2,14'-pentacyclo[8.8.0.02,7.04,6.011,16]octadeca-9,11(16)-diene] (PubChem CID 67832544) has the molecular formula C27H40O3 and a molecular weight of 412.61 g/mol. Its IUPAC name is (1'S,2'S,4'S,6'R,7'S)-6'-hexoxy-7'-methylspiro[1,3-dioxolane-2,14'-pentacyclo[8.8.0.02,7.04,6.011,16]octadeca-9,11(16)-diene].
| Compound Name | (1'S,2'S,4'S,6'R,7'S)-6'-hexoxy-7'-methylspiro[1,3-dioxolane-2,14'-pentacyclo[8.8.0.02,7.04,6.011,16]octadeca-9,11(16)-diene] |
|---|---|
| PubChem CID | 67832544 |
| Molecular Formula | C27H40O3 |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | (1'S,2'S,4'S,6'R,7'S)-6'-hexoxy-7'-methylspiro[1,3-dioxolane-2,14'-pentacyclo[8.8.0.02,7.04,6.011,16]octadeca-9,11(16)-diene] |
| SMILES | CCCCCCO[C@]12C[C@@H]1C[C@H]1[C@@H]3CCC4=C(CCC5(C4)OCCO5)C3=CC[C@@]12C |
| InChI | InChI=1S/C27H40O3/c1-3-4-5-6-13-30-27-18-20(27)16-24-23-8-7-19-17-26(28-14-15-29-26)12-10-21(19)22(23)9-11-25(24,27)2/h9,20,23-24H,3-8,10-18H2,1-2H3/t20-,23+,24-,25-,27+/m0/s1 |
| InChIKey | LEADUOBXFOXBIG-AMLYNDDESA-N |
| XLogP | 6.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|