About 5-O-(5-hydroxy-2-phenylphenyl) 1-O-prop-2-enyl pentanedioate
5-O-(5-hydroxy-2-phenylphenyl) 1-O-prop-2-enyl pentanedioate (PubChem CID 70400731) has the molecular formula C20H20O5
and a molecular weight of 340.38 g/mol. Its IUPAC name is 5-O-(5-hydroxy-2-phenylphenyl) 1-O-prop-2-enyl pentanedioate.
Molecular Properties
| Compound Name | 5-O-(5-hydroxy-2-phenylphenyl) 1-O-prop-2-enyl pentanedioate |
| PubChem CID | 70400731 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 5-O-(5-hydroxy-2-phenylphenyl) 1-O-prop-2-enyl pentanedioate |
| SMILES | C=CCOC(=O)CCCC(=O)Oc1cc(O)ccc1-c1ccccc1 |
| InChI | InChI=1S/C20H20O5/c1-2-13-24-19(22)9-6-10-20(23)25-18-14-16(21)11-12-17(18)15-7-4-3-5-8-15/h2-5,7-8,11-12,14,21H,1,6,9-10,13H2 |
| InChIKey | PITXQRURLKUFHR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 5-O-(5-hydroxy-2-phenylphenyl) 1-O-prop-2-enyl pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-(5-hydroxy-2-phenylphenyl) 1-O-prop-2-enyl pentanedioate?
The IUPAC name of 5-O-(5-hydroxy-2-phenylphenyl) 1-O-prop-2-enyl pentanedioate (CID 70400731) is 5-O-(5-hydroxy-2-phenylphenyl) 1-O-prop-2-enyl pentanedioate.
What is the SMILES notation for 5-O-(5-hydroxy-2-phenylphenyl) 1-O-prop-2-enyl pentanedioate?
The canonical SMILES for 5-O-(5-hydroxy-2-phenylphenyl) 1-O-prop-2-enyl pentanedioate is C=CCOC(=O)CCCC(=O)Oc1cc(O)ccc1-c1ccccc1.
What is the InChIKey of 5-O-(5-hydroxy-2-phenylphenyl) 1-O-prop-2-enyl pentanedioate?
The InChIKey is PITXQRURLKUFHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20O5/c1-2-13-24-19(22)9-6-10-20(23)25-18-14-16(21)11-12-17(18)15-7-4-3-5-8-15/h2-5,7-8,11-12,14,21H,1,6,9-10,13H2.
What are the key properties of 5-O-(5-hydroxy-2-phenylphenyl) 1-O-prop-2-enyl pentanedioate?
5-O-(5-hydroxy-2-phenylphenyl) 1-O-prop-2-enyl pentanedioate has a molecular weight of 340.38 g/mol, XLogP of 3.86, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-(5-hydroxy-2-phenylphenyl) 1-O-prop-2-enyl pentanedioate is sourced from PubChem (CID 70400731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).