C32H54Cl2O2 — CID 70401081
(8S)-14,14-dichloro-13,13-bis(4-propoxycyclohexyl)dispiro[5.1.58.16]tetradecane (PubChem CID 70401081) has the molecular formula C32H54Cl2O2 and a molecular weight of 541.69 g/mol. Its IUPAC name is (8S)-14,14-dichloro-13,13-bis(4-propoxycyclohexyl)dispiro[5.1.58.16]tetradecane.
| Compound Name | (8S)-14,14-dichloro-13,13-bis(4-propoxycyclohexyl)dispiro[5.1.58.16]tetradecane |
|---|---|
| PubChem CID | 70401081 |
| Molecular Formula | C32H54Cl2O2 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 540.35 |
| IUPAC Name | (8S)-14,14-dichloro-13,13-bis(4-propoxycyclohexyl)dispiro[5.1.58.16]tetradecane |
| SMILES | CCCOC1CCC(C2(C3CCC(OCCC)CC3)CCCC[C@]23CC2(CCCCC2)C3(Cl)Cl)CC1 |
| InChI | InChI=1S/C32H54Cl2O2/c1-3-22-35-27-14-10-25(11-15-27)31(26-12-16-28(17-13-26)36-23-4-2)21-9-8-20-30(31)24-29(32(30,33)34)18-6-5-7-19-29/h25-28H,3-24H2,1-2H3/t25?,26?,27?,28?,30-,31?/m0/s1 |
| InChIKey | JEFJCPWUHDEDAY-VVFXJSTASA-N |
| XLogP | 10.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|