C20H29NO2 — CID 70402640
(8R,9S,10R,13S,14S,17Z)-10,13-dimethyl-17-(nitromethylidene)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene (PubChem CID 70402640) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17Z)-10,13-dimethyl-17-(nitromethylidene)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene.
| Compound Name | (8R,9S,10R,13S,14S,17Z)-10,13-dimethyl-17-(nitromethylidene)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 70402640 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | (8R,9S,10R,13S,14S,17Z)-10,13-dimethyl-17-(nitromethylidene)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene |
| SMILES | C[C@]12CCCCC1=CC[C@@H]1[C@@H]2CC[C@]2(C)/C(=C\[N+](=O)[O-])CC[C@@H]12 |
| InChI | InChI=1S/C20H29NO2/c1-19-11-4-3-5-14(19)6-8-16-17-9-7-15(13-21(22)23)20(17,2)12-10-18(16)19/h6,13,16-18H,3-5,7-12H2,1-2H3/b15-13-/t16-,17-,18-,19-,20+/m0/s1 |
| InChIKey | FRPJEYICEQXXAX-BUMSCIKOSA-N |
| XLogP | 5.50 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|