C15H23NO4P+ — CID 70404909
[2-[(2,4-dimethyl-3-phenylpentan-3-yl)amino]-2-oxoethoxy]-hydroxy-oxophosphanium (PubChem CID 70404909) has the molecular formula C15H23NO4P+ and a molecular weight of 312.33 g/mol. Its IUPAC name is [2-[(2,4-dimethyl-3-phenylpentan-3-yl)amino]-2-oxoethoxy]-hydroxy-oxophosphanium.
| Compound Name | [2-[(2,4-dimethyl-3-phenylpentan-3-yl)amino]-2-oxoethoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 70404909 |
| Molecular Formula | C15H23NO4P+ |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | [2-[(2,4-dimethyl-3-phenylpentan-3-yl)amino]-2-oxoethoxy]-hydroxy-oxophosphanium |
| SMILES | CC(C)C(NC(=O)CO[P+](=O)O)(c1ccccc1)C(C)C |
| InChI | InChI=1S/C15H22NO4P/c1-11(2)15(12(3)4,13-8-6-5-7-9-13)16-14(17)10-20-21(18)19/h5-9,11-12H,10H2,1-4H3,(H-,16,17,18,19)/p+1 |
| InChIKey | KNTUPBOEFULWCK-UHFFFAOYSA-O |
| XLogP | 2.98 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|