About 3-indol-1-ylbenzamide;hydrochloride
3-indol-1-ylbenzamide;hydrochloride (PubChem CID 70409706) has the molecular formula C15H13ClN2O
and a molecular weight of 272.74 g/mol. Its IUPAC name is 3-indol-1-ylbenzamide;hydrochloride.
Molecular Properties
| Compound Name | 3-indol-1-ylbenzamide;hydrochloride |
| PubChem CID | 70409706 |
| Molecular Formula | C15H13ClN2O |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 3-indol-1-ylbenzamide;hydrochloride |
| SMILES | Cl.NC(=O)c1cccc(-n2ccc3ccccc32)c1 |
| InChI | InChI=1S/C15H12N2O.ClH/c16-15(18)12-5-3-6-13(10-12)17-9-8-11-4-1-2-7-14(11)17;/h1-10H,(H2,16,18);1H |
| InChIKey | YCPRHPUUHXSYIL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-indol-1-ylbenzamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-indol-1-ylbenzamide;hydrochloride?
The IUPAC name of 3-indol-1-ylbenzamide;hydrochloride (CID 70409706) is 3-indol-1-ylbenzamide;hydrochloride.
What is the SMILES notation for 3-indol-1-ylbenzamide;hydrochloride?
The canonical SMILES for 3-indol-1-ylbenzamide;hydrochloride is Cl.NC(=O)c1cccc(-n2ccc3ccccc32)c1.
What is the InChIKey of 3-indol-1-ylbenzamide;hydrochloride?
The InChIKey is YCPRHPUUHXSYIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O.ClH/c16-15(18)12-5-3-6-13(10-12)17-9-8-11-4-1-2-7-14(11)17;/h1-10H,(H2,16,18);1H.
What are the key properties of 3-indol-1-ylbenzamide;hydrochloride?
3-indol-1-ylbenzamide;hydrochloride has a molecular weight of 272.74 g/mol, XLogP of 3.15, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-indol-1-ylbenzamide;hydrochloride is sourced from PubChem (CID 70409706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).