C20H27N3O5 — CID 7041034
2-[(4R)-4-cyclohexyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2,4-dimethoxyphenyl)acetamide (PubChem CID 7041034) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is 2-[(4R)-4-cyclohexyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-[(4R)-4-cyclohexyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 7041034 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 2-[(4R)-4-cyclohexyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CN2C(=O)N[C@](C)(C3CCCCC3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C20H27N3O5/c1-20(13-7-5-4-6-8-13)18(25)23(19(26)22-20)12-17(24)21-15-10-9-14(27-2)11-16(15)28-3/h9-11,13H,4-8,12H2,1-3H3,(H,21,24)(H,22,26)/t20-/m1/s1 |
| InChIKey | YJPZYTHUNKARFS-HXUWFJFHSA-N |
| XLogP | 2.53 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|