C19H24FN3O3 — CID 7618626
2-[(4R)-4-cyclohexyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-fluoro-4-methylphenyl)acetamide (PubChem CID 7618626) has the molecular formula C19H24FN3O3 and a molecular weight of 361.42 g/mol. Its IUPAC name is 2-[(4R)-4-cyclohexyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-fluoro-4-methylphenyl)acetamide.
| Compound Name | 2-[(4R)-4-cyclohexyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-fluoro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 7618626 |
| Molecular Formula | C19H24FN3O3 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 2-[(4R)-4-cyclohexyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-fluoro-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)N[C@](C)(C3CCCCC3)C2=O)c(F)c1 |
| InChI | InChI=1S/C19H24FN3O3/c1-12-8-9-15(14(20)10-12)21-16(24)11-23-17(25)19(2,22-18(23)26)13-6-4-3-5-7-13/h8-10,13H,3-7,11H2,1-2H3,(H,21,24)(H,22,26)/t19-/m1/s1 |
| InChIKey | WAQSEXIQVRQADE-LJQANCHMSA-N |
| XLogP | 2.96 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|