C27H43NO4S — CID 70413087
5-(2-aminophenyl)sulfanyl-1-phenylnonan-4-ol;hexanoic acid;hydrate (PubChem CID 70413087) has the molecular formula C27H43NO4S and a molecular weight of 477.71 g/mol. Its IUPAC name is 5-(2-aminophenyl)sulfanyl-1-phenylnonan-4-ol;hexanoic acid;hydrate.
| Compound Name | 5-(2-aminophenyl)sulfanyl-1-phenylnonan-4-ol;hexanoic acid;hydrate |
|---|---|
| PubChem CID | 70413087 |
| Molecular Formula | C27H43NO4S |
| Molecular Weight | 477.71 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | 5-(2-aminophenyl)sulfanyl-1-phenylnonan-4-ol;hexanoic acid;hydrate |
| SMILES | CCCCC(Sc1ccccc1N)C(O)CCCc1ccccc1.CCCCCC(=O)O.O |
| InChI | InChI=1S/C21H29NOS.C6H12O2.H2O/c1-2-3-15-21(24-20-16-8-7-13-18(20)22)19(23)14-9-12-17-10-5-4-6-11-17;1-2-3-4-5-6(7)8;/h4-8,10-11,13,16,19,21,23H,2-3,9,12,14-15,22H2,1H3;2-5H2,1H3,(H,7,8);1H2 |
| InChIKey | OIKLNTPJFHJODR-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.71 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|