C31H42N2O4S — CID 70413188
methyl 6-[3-[(2-cyanoacetyl)amino]phenyl]sulfanyl-5-hydroxy-6-(4-nonylphenyl)hexanoate (PubChem CID 70413188) has the molecular formula C31H42N2O4S and a molecular weight of 538.75 g/mol. Its IUPAC name is methyl 6-[3-[(2-cyanoacetyl)amino]phenyl]sulfanyl-5-hydroxy-6-(4-nonylphenyl)hexanoate.
| Compound Name | methyl 6-[3-[(2-cyanoacetyl)amino]phenyl]sulfanyl-5-hydroxy-6-(4-nonylphenyl)hexanoate |
|---|---|
| PubChem CID | 70413188 |
| Molecular Formula | C31H42N2O4S |
| Molecular Weight | 538.75 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | methyl 6-[3-[(2-cyanoacetyl)amino]phenyl]sulfanyl-5-hydroxy-6-(4-nonylphenyl)hexanoate |
| SMILES | CCCCCCCCCc1ccc(C(Sc2cccc(NC(=O)CC#N)c2)C(O)CCCC(=O)OC)cc1 |
| InChI | InChI=1S/C31H42N2O4S/c1-3-4-5-6-7-8-9-12-24-17-19-25(20-18-24)31(28(34)15-11-16-30(36)37-2)38-27-14-10-13-26(23-27)33-29(35)21-22-32/h10,13-14,17-20,23,28,31,34H,3-9,11-12,15-16,21H2,1-2H3,(H,33,35) |
| InChIKey | UXXPZDSBFLKGRL-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.75 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|