C21H15NO5 — CID 70413487
(Z)-but-2-enedioic acid;1-phenyl-[1]benzofuro[3,2-c]pyridine (PubChem CID 70413487) has the molecular formula C21H15NO5 and a molecular weight of 361.35 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-phenyl-[1]benzofuro[3,2-c]pyridine.
| Compound Name | (Z)-but-2-enedioic acid;1-phenyl-[1]benzofuro[3,2-c]pyridine |
|---|---|
| PubChem CID | 70413487 |
| Molecular Formula | C21H15NO5 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-phenyl-[1]benzofuro[3,2-c]pyridine |
| SMILES | O=C(O)/C=C\C(=O)O.c1ccc(-c2nccc3oc4ccccc4c23)cc1 |
| InChI | InChI=1S/C17H11NO.C4H4O4/c1-2-6-12(7-3-1)17-16-13-8-4-5-9-14(13)19-15(16)10-11-18-17;5-3(6)1-2-4(7)8/h1-11H;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | HZXBXKOXNNXNES-BTJKTKAUSA-N |
| XLogP | 4.36 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|