C36H51NO — CID 70413914
2-[4-(4-decoxyphenyl)phenyl]-5-(2,6-dimethylheptyl)pyridine (PubChem CID 70413914) has the molecular formula C36H51NO and a molecular weight of 513.81 g/mol. Its IUPAC name is 2-[4-(4-decoxyphenyl)phenyl]-5-(2,6-dimethylheptyl)pyridine.
| Compound Name | 2-[4-(4-decoxyphenyl)phenyl]-5-(2,6-dimethylheptyl)pyridine |
|---|---|
| PubChem CID | 70413914 |
| Molecular Formula | C36H51NO |
| Molecular Weight | 513.81 g/mol |
| Exact Mass | 513.40 |
| IUPAC Name | 2-[4-(4-decoxyphenyl)phenyl]-5-(2,6-dimethylheptyl)pyridine |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(-c3ccc(CC(C)CCCC(C)C)cn3)cc2)cc1 |
| InChI | InChI=1S/C36H51NO/c1-5-6-7-8-9-10-11-12-26-38-35-23-21-33(22-24-35)32-17-19-34(20-18-32)36-25-16-31(28-37-36)27-30(4)15-13-14-29(2)3/h16-25,28-30H,5-15,26-27H2,1-4H3 |
| InChIKey | VNALQWJFDJYPAY-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.81 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|