C69H96N2O2 — CID 88646102
5-(2,6-dimethylheptyl)-2-[4-(4-nonoxyphenyl)phenyl]pyridine;5-(2,6-dimethylheptyl)-2-[4-(4-octoxyphenyl)phenyl]pyridine (PubChem CID 88646102) has the molecular formula C69H96N2O2 and a molecular weight of 985.54 g/mol. Its IUPAC name is 5-(2,6-dimethylheptyl)-2-[4-(4-nonoxyphenyl)phenyl]pyridine;5-(2,6-dimethylheptyl)-2-[4-(4-octoxyphenyl)phenyl]pyridine.
| Compound Name | 5-(2,6-dimethylheptyl)-2-[4-(4-nonoxyphenyl)phenyl]pyridine;5-(2,6-dimethylheptyl)-2-[4-(4-octoxyphenyl)phenyl]pyridine |
|---|---|
| PubChem CID | 88646102 |
| Molecular Formula | C69H96N2O2 |
| Molecular Weight | 985.54 g/mol |
| Exact Mass | 984.75 |
| IUPAC Name | 5-(2,6-dimethylheptyl)-2-[4-(4-nonoxyphenyl)phenyl]pyridine;5-(2,6-dimethylheptyl)-2-[4-(4-octoxyphenyl)phenyl]pyridine |
| SMILES | CCCCCCCCCOc1ccc(-c2ccc(-c3ccc(CC(C)CCCC(C)C)cn3)cc2)cc1.CCCCCCCCOc1ccc(-c2ccc(-c3ccc(CC(C)CCCC(C)C)cn3)cc2)cc1 |
| InChI | InChI=1S/C35H49NO.C34H47NO/c1-5-6-7-8-9-10-11-25-37-34-22-20-32(21-23-34)31-16-18-33(19-17-31)35-24-15-30(27-36-35)26-29(4)14-12-13-28(2)3;1-5-6-7-8-9-10-24-36-33-21-19-31(20-22-33)30-15-17-32(18-16-30)34-23-14-29(26-35-34)25-28(4)13-11-12-27(2)3/h15-24,27-29H,5-14,25-26H2,1-4H3;14-23,26-28H,5-13,24-25H2,1-4H3 |
| InChIKey | ZKCCCYMJFPSSDB-UHFFFAOYSA-N |
| XLogP | 20.71 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 985.54 |
| LogP ≤ 5 | 20.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|