C18H23N3O2 — CID 70414337
[1-(2-ethylphenyl)piperidin-4-yl]-pyrrol-1-ylcarbamic acid (PubChem CID 70414337) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is [1-(2-ethylphenyl)piperidin-4-yl]-pyrrol-1-ylcarbamic acid.
| Compound Name | [1-(2-ethylphenyl)piperidin-4-yl]-pyrrol-1-ylcarbamic acid |
|---|---|
| PubChem CID | 70414337 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | [1-(2-ethylphenyl)piperidin-4-yl]-pyrrol-1-ylcarbamic acid |
| SMILES | CCc1ccccc1N1CCC(N(C(=O)O)n2cccc2)CC1 |
| InChI | InChI=1S/C18H23N3O2/c1-2-15-7-3-4-8-17(15)19-13-9-16(10-14-19)21(18(22)23)20-11-5-6-12-20/h3-8,11-12,16H,2,9-10,13-14H2,1H3,(H,22,23) |
| InChIKey | KICHSDXDFZVHQC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |