C31H39N3O5 — CID 70414982
(2S)-1-[(2S)-2-[(3-benzamido-2-oxo-4-phenylbutyl)amino]propanoyl]-4-cyclohexylpyrrolidine-2-carboxylic acid (PubChem CID 70414982) has the molecular formula C31H39N3O5 and a molecular weight of 533.67 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[(3-benzamido-2-oxo-4-phenylbutyl)amino]propanoyl]-4-cyclohexylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-2-[(3-benzamido-2-oxo-4-phenylbutyl)amino]propanoyl]-4-cyclohexylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70414982 |
| Molecular Formula | C31H39N3O5 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.29 |
| IUPAC Name | (2S)-1-[(2S)-2-[(3-benzamido-2-oxo-4-phenylbutyl)amino]propanoyl]-4-cyclohexylpyrrolidine-2-carboxylic acid |
| SMILES | C[C@H](NCC(=O)C(Cc1ccccc1)NC(=O)c1ccccc1)C(=O)N1CC(C2CCCCC2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C31H39N3O5/c1-21(30(37)34-20-25(18-27(34)31(38)39)23-13-7-3-8-14-23)32-19-28(35)26(17-22-11-5-2-6-12-22)33-29(36)24-15-9-4-10-16-24/h2,4-6,9-12,15-16,21,23,25-27,32H,3,7-8,13-14,17-20H2,1H3,(H,33,36)(H,38,39)/t21-,25?,26?,27-/m0/s1 |
| InChIKey | RGJVFHLQKFLUPA-LLAPMXRRSA-N |
| XLogP | 3.46 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |