C28H30O8 — CID 70415885
diethyl 6-[1-(2-ethylphenyl)propylidene]-5,7-dioxo-3-phenyl-1,4-dioxepane-2,2-dicarboxylate (PubChem CID 70415885) has the molecular formula C28H30O8 and a molecular weight of 494.54 g/mol. Its IUPAC name is diethyl 6-[1-(2-ethylphenyl)propylidene]-5,7-dioxo-3-phenyl-1,4-dioxepane-2,2-dicarboxylate.
| Compound Name | diethyl 6-[1-(2-ethylphenyl)propylidene]-5,7-dioxo-3-phenyl-1,4-dioxepane-2,2-dicarboxylate |
|---|---|
| PubChem CID | 70415885 |
| Molecular Formula | C28H30O8 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | diethyl 6-[1-(2-ethylphenyl)propylidene]-5,7-dioxo-3-phenyl-1,4-dioxepane-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)OC(=O)C(=C(CC)c2ccccc2CC)C(=O)OC1c1ccccc1 |
| InChI | InChI=1S/C28H30O8/c1-5-18-14-12-13-17-21(18)20(6-2)22-24(29)35-23(19-15-10-9-11-16-19)28(36-25(22)30,26(31)33-7-3)27(32)34-8-4/h9-17,23H,5-8H2,1-4H3 |
| InChIKey | TVYNJWTUTWNVSI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|