About ethyl 3-[2-(1,2-dibromopropan-2-yl)-6-methylphenyl]imidazole-4-carboxylate
ethyl 3-[2-(1,2-dibromopropan-2-yl)-6-methylphenyl]imidazole-4-carboxylate (PubChem CID 70416355) has the molecular formula C16H18Br2N2O2
and a molecular weight of 430.14 g/mol. Its IUPAC name is ethyl 3-[2-(1,2-dibromopropan-2-yl)-6-methylphenyl]imidazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-[2-(1,2-dibromopropan-2-yl)-6-methylphenyl]imidazole-4-carboxylate |
| PubChem CID | 70416355 |
| Molecular Formula | C16H18Br2N2O2 |
| Molecular Weight | 430.14 g/mol |
| Exact Mass | 427.97 |
| IUPAC Name | ethyl 3-[2-(1,2-dibromopropan-2-yl)-6-methylphenyl]imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cncn1-c1c(C)cccc1C(C)(Br)CBr |
| InChI | InChI=1S/C16H18Br2N2O2/c1-4-22-15(21)13-8-19-10-20(13)14-11(2)6-5-7-12(14)16(3,18)9-17/h5-8,10H,4,9H2,1-3H3 |
| InChIKey | LOFMDNHUSBLYCF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.14 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[2-(1,2-dibromopropan-2-yl)-6-methylphenyl]imidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[2-(1,2-dibromopropan-2-yl)-6-methylphenyl]imidazole-4-carboxylate?
The IUPAC name of ethyl 3-[2-(1,2-dibromopropan-2-yl)-6-methylphenyl]imidazole-4-carboxylate (CID 70416355) is ethyl 3-[2-(1,2-dibromopropan-2-yl)-6-methylphenyl]imidazole-4-carboxylate.
What is the SMILES notation for ethyl 3-[2-(1,2-dibromopropan-2-yl)-6-methylphenyl]imidazole-4-carboxylate?
The canonical SMILES for ethyl 3-[2-(1,2-dibromopropan-2-yl)-6-methylphenyl]imidazole-4-carboxylate is CCOC(=O)c1cncn1-c1c(C)cccc1C(C)(Br)CBr.
What is the InChIKey of ethyl 3-[2-(1,2-dibromopropan-2-yl)-6-methylphenyl]imidazole-4-carboxylate?
The InChIKey is LOFMDNHUSBLYCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18Br2N2O2/c1-4-22-15(21)13-8-19-10-20(13)14-11(2)6-5-7-12(14)16(3,18)9-17/h5-8,10H,4,9H2,1-3H3.
What are the key properties of ethyl 3-[2-(1,2-dibromopropan-2-yl)-6-methylphenyl]imidazole-4-carboxylate?
ethyl 3-[2-(1,2-dibromopropan-2-yl)-6-methylphenyl]imidazole-4-carboxylate has a molecular weight of 430.14 g/mol, XLogP of 4.36, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[2-(1,2-dibromopropan-2-yl)-6-methylphenyl]imidazole-4-carboxylate is sourced from PubChem (CID 70416355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).