C16H18Br2N2O2 — CID 70416355
ethyl 3-[2-(1,2-dibromopropan-2-yl)-6-methylphenyl]imidazole-4-carboxylate (PubChem CID 70416355) has the molecular formula C16H18Br2N2O2 and a molecular weight of 430.14 g/mol. Its IUPAC name is ethyl 3-[2-(1,2-dibromopropan-2-yl)-6-methylphenyl]imidazole-4-carboxylate.
| Compound Name | ethyl 3-[2-(1,2-dibromopropan-2-yl)-6-methylphenyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 70416355 |
| Molecular Formula | C16H18Br2N2O2 |
| Molecular Weight | 430.14 g/mol |
| Exact Mass | 427.97 |
| IUPAC Name | ethyl 3-[2-(1,2-dibromopropan-2-yl)-6-methylphenyl]imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cncn1-c1c(C)cccc1C(C)(Br)CBr |
| InChI | InChI=1S/C16H18Br2N2O2/c1-4-22-15(21)13-8-19-10-20(13)14-11(2)6-5-7-12(14)16(3,18)9-17/h5-8,10H,4,9H2,1-3H3 |
| InChIKey | LOFMDNHUSBLYCF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.14 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|