C10H14N2O3 — CID 70416770
2-[2-[methyl(pyridin-3-yl)amino]ethoxy]acetic acid (PubChem CID 70416770) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-[2-[methyl(pyridin-3-yl)amino]ethoxy]acetic acid.
| Compound Name | 2-[2-[methyl(pyridin-3-yl)amino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 70416770 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 2-[2-[methyl(pyridin-3-yl)amino]ethoxy]acetic acid |
| SMILES | CN(CCOCC(=O)O)c1cccnc1 |
| InChI | InChI=1S/C10H14N2O3/c1-12(5-6-15-8-10(13)14)9-3-2-4-11-7-9/h2-4,7H,5-6,8H2,1H3,(H,13,14) |
| InChIKey | MVEKRDUABZWFBT-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|