C33H40Cl3N3O7 — CID 70423228
2-O-benzyl 6-O-(2,2,2-trichloroethyl) 1-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-2,6-dicarboxylate (PubChem CID 70423228) has the molecular formula C33H40Cl3N3O7 and a molecular weight of 697.06 g/mol. Its IUPAC name is 2-O-benzyl 6-O-(2,2,2-trichloroethyl) 1-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-2,6-dicarboxylate.
| Compound Name | 2-O-benzyl 6-O-(2,2,2-trichloroethyl) 1-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 70423228 |
| Molecular Formula | C33H40Cl3N3O7 |
| Molecular Weight | 697.06 g/mol |
| Exact Mass | 695.19 |
| IUPAC Name | 2-O-benzyl 6-O-(2,2,2-trichloroethyl) 1-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-2,6-dicarboxylate |
| SMILES | CCOC(=O)C(CCc1ccccc1)N[C@@H](C)C(=O)N1C(C(=O)OCc2ccccc2)CC2CCN(C(=O)OCC(Cl)(Cl)Cl)CC21 |
| InChI | InChI=1S/C33H40Cl3N3O7/c1-3-44-30(41)26(15-14-23-10-6-4-7-11-23)37-22(2)29(40)39-27(31(42)45-20-24-12-8-5-9-13-24)18-25-16-17-38(19-28(25)39)32(43)46-21-33(34,35)36/h4-13,22,25-28,37H,3,14-21H2,1-2H3/t22-,25?,26?,27?,28?/m0/s1 |
| InChIKey | WFUDQESOGGWQLT-CIPBXAIYSA-N |
| XLogP | 5.07 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.06 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|