C30H39N3O5 — CID 99867085
benzyl (2R,3aR,7aR)-1-[(2S)-2-[[(2R)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridine-2-carboxylate (PubChem CID 99867085) has the molecular formula C30H39N3O5 and a molecular weight of 521.66 g/mol. Its IUPAC name is benzyl (2R,3aR,7aR)-1-[(2S)-2-[[(2R)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridine-2-carboxylate.
| Compound Name | benzyl (2R,3aR,7aR)-1-[(2S)-2-[[(2R)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 99867085 |
| Molecular Formula | C30H39N3O5 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.29 |
| IUPAC Name | benzyl (2R,3aR,7aR)-1-[(2S)-2-[[(2R)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H](CCc1ccccc1)N[C@@H](C)C(=O)N1[C@@H](C(=O)OCc2ccccc2)C[C@H]2CCNC[C@@H]21 |
| InChI | InChI=1S/C30H39N3O5/c1-3-37-29(35)25(15-14-22-10-6-4-7-11-22)32-21(2)28(34)33-26(18-24-16-17-31-19-27(24)33)30(36)38-20-23-12-8-5-9-13-23/h4-13,21,24-27,31-32H,3,14-20H2,1-2H3/t21-,24+,25+,26+,27-/m0/s1 |
| InChIKey | SKIBCOOCUAHQIG-CEISPFGFSA-N |
| XLogP | 2.85 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |