C30H36O6 — CID 70424637
[2-[(8S,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 3-phenylpropanoate (PubChem CID 70424637) has the molecular formula C30H36O6 and a molecular weight of 492.61 g/mol. Its IUPAC name is [2-[(8S,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 3-phenylpropanoate.
| Compound Name | [2-[(8S,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 70424637 |
| Molecular Formula | C30H36O6 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | [2-[(8S,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 3-phenylpropanoate |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2C(=O)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)COC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C30H36O6/c1-28-14-12-21(31)16-20(28)9-10-22-23-13-15-30(35,29(23,2)17-24(32)27(22)28)25(33)18-36-26(34)11-8-19-6-4-3-5-7-19/h3-7,16,22-23,27,35H,8-15,17-18H2,1-2H3/t22-,23-,27+,28-,29-,30-/m0/s1 |
| InChIKey | RTWMOXWEPNFSLS-DXQCBORDSA-N |
| XLogP | 4.17 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'steroid_A(2)', 'substructure': 'N/A'} |
|---|