C16H18FN5O6 — CID 70424963
[6-fluoro-1-(methylamino)-7-(4-methylpiperazin-1-yl)-8-nitro-4-oxoquinolin-3-yl] hydrogen carbonate (PubChem CID 70424963) has the molecular formula C16H18FN5O6 and a molecular weight of 395.35 g/mol. Its IUPAC name is [6-fluoro-1-(methylamino)-7-(4-methylpiperazin-1-yl)-8-nitro-4-oxoquinolin-3-yl] hydrogen carbonate.
| Compound Name | [6-fluoro-1-(methylamino)-7-(4-methylpiperazin-1-yl)-8-nitro-4-oxoquinolin-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70424963 |
| Molecular Formula | C16H18FN5O6 |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | [6-fluoro-1-(methylamino)-7-(4-methylpiperazin-1-yl)-8-nitro-4-oxoquinolin-3-yl] hydrogen carbonate |
| SMILES | CNn1cc(OC(=O)O)c(=O)c2cc(F)c(N3CCN(C)CC3)c([N+](=O)[O-])c21 |
| InChI | InChI=1S/C16H18FN5O6/c1-18-21-8-11(28-16(24)25)15(23)9-7-10(17)13(14(12(9)21)22(26)27)20-5-3-19(2)4-6-20/h7-8,18H,3-6H2,1-2H3,(H,24,25) |
| InChIKey | KWDJTLBKELEPCD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 130.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|