C18H19N3O4S — CID 70425313
2-(5H-[1,3]dioxolo[4,5-f]benzimidazol-6-ylsulfinylmethyl)-4-methoxy-N,N-dimethylaniline (PubChem CID 70425313) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is 2-(5H-[1,3]dioxolo[4,5-f]benzimidazol-6-ylsulfinylmethyl)-4-methoxy-N,N-dimethylaniline.
| Compound Name | 2-(5H-[1,3]dioxolo[4,5-f]benzimidazol-6-ylsulfinylmethyl)-4-methoxy-N,N-dimethylaniline |
|---|---|
| PubChem CID | 70425313 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2-(5H-[1,3]dioxolo[4,5-f]benzimidazol-6-ylsulfinylmethyl)-4-methoxy-N,N-dimethylaniline |
| SMILES | COc1ccc(N(C)C)c(CS(=O)c2nc3cc4c(cc3[nH]2)OCO4)c1 |
| InChI | InChI=1S/C18H19N3O4S/c1-21(2)15-5-4-12(23-3)6-11(15)9-26(22)18-19-13-7-16-17(25-10-24-16)8-14(13)20-18/h4-8H,9-10H2,1-3H3,(H,19,20) |
| InChIKey | IJFQEFIUDVYVMD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|