C24H43N — CID 70426832
(8R,9R,10S,13S,14S)-10,13-dimethyl-17-pentyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-amine (PubChem CID 70426832) has the molecular formula C24H43N and a molecular weight of 345.62 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-10,13-dimethyl-17-pentyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-amine.
| Compound Name | (8R,9R,10S,13S,14S)-10,13-dimethyl-17-pentyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-amine |
|---|---|
| PubChem CID | 70426832 |
| Molecular Formula | C24H43N |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 345.34 |
| IUPAC Name | (8R,9R,10S,13S,14S)-10,13-dimethyl-17-pentyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-amine |
| SMILES | CCCCCC1(N)CC[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C24H43N/c1-4-5-7-15-24(25)17-13-21-19-11-10-18-9-6-8-14-22(18,2)20(19)12-16-23(21,24)3/h18-21H,4-17,25H2,1-3H3/t18?,19-,20-,21+,22+,23+,24?/m1/s1 |
| InChIKey | XIIRICOXWHGWQD-XDHWCONUSA-N |
| XLogP | 6.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|