C20H32S — CID 99567170
(5R,8R,9S,10S,13S,14S,17R)-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-thiirane] (PubChem CID 99567170) has the molecular formula C20H32S and a molecular weight of 304.54 g/mol. Its IUPAC name is (5R,8R,9S,10S,13S,14S,17R)-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-thiirane].
| Compound Name | (5R,8R,9S,10S,13S,14S,17R)-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-thiirane] |
|---|---|
| PubChem CID | 99567170 |
| Molecular Formula | C20H32S |
| Molecular Weight | 304.54 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (5R,8R,9S,10S,13S,14S,17R)-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-thiirane] |
| SMILES | C[C@]12CCCC[C@@H]1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@]21CS1 |
| InChI | InChI=1S/C20H32S/c1-18-10-4-3-5-14(18)6-7-15-16(18)8-11-19(2)17(15)9-12-20(19)13-21-20/h14-17H,3-13H2,1-2H3/t14-,15-,16+,17+,18+,19+,20+/m1/s1 |
| InChIKey | GNGCLVAAJKWTTQ-PAPWGAKMSA-N |
| XLogP | 5.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.54 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|