C21H32S2 — CID 124902285
CID 124902285 (PubChem CID 124902285) has the molecular formula C21H32S2 and a molecular weight of 348.62 g/mol.
| Compound Name | CID 124902285 |
|---|---|
| PubChem CID | 124902285 |
| Molecular Formula | C21H32S2 |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | — |
| SMILES | C[C@]12CC[C@@]3(CS3)C[C@@H]1CC[C@@H]1[C@H]2CC[C@@]2(C)[C@H]1CC[C@]21CS1 |
| InChI | InChI=1S/C21H32S2/c1-18-9-10-20(12-22-20)11-14(18)3-4-15-16(18)5-7-19(2)17(15)6-8-21(19)13-23-21/h14-17H,3-13H2,1-2H3/t14-,15+,16+,17-,18-,19-,20-,21-/m0/s1 |
| InChIKey | GIBFGVLFEQJQJA-JRRMKBMNSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|