C18H30S — CID 14541662
(3aS,3bR,5aR,9aS,9bS,11aS)-9a,11a-dimethyl-1,3,3a,3b,4,5,5a,6,7,8,9,9b,10,11-tetradecahydrophenanthro[1,2-c]thiophene (PubChem CID 14541662) has the molecular formula C18H30S and a molecular weight of 278.50 g/mol. Its IUPAC name is (3aS,3bR,5aR,9aS,9bS,11aS)-9a,11a-dimethyl-1,3,3a,3b,4,5,5a,6,7,8,9,9b,10,11-tetradecahydrophenanthro[1,2-c]thiophene.
| Compound Name | (3aS,3bR,5aR,9aS,9bS,11aS)-9a,11a-dimethyl-1,3,3a,3b,4,5,5a,6,7,8,9,9b,10,11-tetradecahydrophenanthro[1,2-c]thiophene |
|---|---|
| PubChem CID | 14541662 |
| Molecular Formula | C18H30S |
| Molecular Weight | 278.50 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | (3aS,3bR,5aR,9aS,9bS,11aS)-9a,11a-dimethyl-1,3,3a,3b,4,5,5a,6,7,8,9,9b,10,11-tetradecahydrophenanthro[1,2-c]thiophene |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC[C@H]4CCCC[C@@]43C)[C@@H]1CSC2 |
| InChI | InChI=1S/C18H30S/c1-17-10-8-15-14(16(17)11-19-12-17)7-6-13-5-3-4-9-18(13,15)2/h13-16H,3-12H2,1-2H3/t13-,14-,15+,16+,17-,18+/m1/s1 |
| InChIKey | OYMIPCBMURCSIT-LMMHAMTPSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |