C10H17N3O4S — CID 70426989
ethyl 5-methyl-3-(2-sulfamoylpropan-2-yl)-1H-pyrazole-4-carboxylate (PubChem CID 70426989) has the molecular formula C10H17N3O4S and a molecular weight of 275.33 g/mol. Its IUPAC name is ethyl 5-methyl-3-(2-sulfamoylpropan-2-yl)-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-methyl-3-(2-sulfamoylpropan-2-yl)-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 70426989 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | ethyl 5-methyl-3-(2-sulfamoylpropan-2-yl)-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C(C)(C)S(N)(=O)=O)n[nH]c1C |
| InChI | InChI=1S/C10H17N3O4S/c1-5-17-9(14)7-6(2)12-13-8(7)10(3,4)18(11,15)16/h5H2,1-4H3,(H,12,13)(H2,11,15,16) |
| InChIKey | PFJPBMWXWIALMF-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |