C18H15FN4OS — CID 7042834
2-(benzimidazol-1-yl)-N'-(6-fluoro-2H-thiochromen-4-yl)acetohydrazide (PubChem CID 7042834) has the molecular formula C18H15FN4OS and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-(benzimidazol-1-yl)-N'-(6-fluoro-2H-thiochromen-4-yl)acetohydrazide.
| Compound Name | 2-(benzimidazol-1-yl)-N'-(6-fluoro-2H-thiochromen-4-yl)acetohydrazide |
|---|---|
| PubChem CID | 7042834 |
| Molecular Formula | C18H15FN4OS |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 2-(benzimidazol-1-yl)-N'-(6-fluoro-2H-thiochromen-4-yl)acetohydrazide |
| SMILES | O=C(Cn1cnc2ccccc21)NNC1=CCSc2ccc(F)cc21 |
| InChI | InChI=1S/C18H15FN4OS/c19-12-5-6-17-13(9-12)14(7-8-25-17)21-22-18(24)10-23-11-20-15-3-1-2-4-16(15)23/h1-7,9,11,21H,8,10H2,(H,22,24) |
| InChIKey | VCYTUXDIFHLFKA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|