C43H56N6O2 — CID 70428472
4-[4-(5-heptylpyrimidin-2-yl)phenoxy]-2-methylbutanenitrile;4-[4-(5-hexylpyrimidin-2-yl)phenoxy]-2-methylbutanenitrile (PubChem CID 70428472) has the molecular formula C43H56N6O2 and a molecular weight of 688.96 g/mol. Its IUPAC name is 4-[4-(5-heptylpyrimidin-2-yl)phenoxy]-2-methylbutanenitrile;4-[4-(5-hexylpyrimidin-2-yl)phenoxy]-2-methylbutanenitrile.
| Compound Name | 4-[4-(5-heptylpyrimidin-2-yl)phenoxy]-2-methylbutanenitrile;4-[4-(5-hexylpyrimidin-2-yl)phenoxy]-2-methylbutanenitrile |
|---|---|
| PubChem CID | 70428472 |
| Molecular Formula | C43H56N6O2 |
| Molecular Weight | 688.96 g/mol |
| Exact Mass | 688.45 |
| IUPAC Name | 4-[4-(5-heptylpyrimidin-2-yl)phenoxy]-2-methylbutanenitrile;4-[4-(5-hexylpyrimidin-2-yl)phenoxy]-2-methylbutanenitrile |
| SMILES | CCCCCCCc1cnc(-c2ccc(OCCC(C)C#N)cc2)nc1.CCCCCCc1cnc(-c2ccc(OCCC(C)C#N)cc2)nc1 |
| InChI | InChI=1S/C22H29N3O.C21H27N3O/c1-3-4-5-6-7-8-19-16-24-22(25-17-19)20-9-11-21(12-10-20)26-14-13-18(2)15-23;1-3-4-5-6-7-18-15-23-21(24-16-18)19-8-10-20(11-9-19)25-13-12-17(2)14-22/h9-12,16-18H,3-8,13-14H2,1-2H3;8-11,15-17H,3-7,12-13H2,1-2H3 |
| InChIKey | DAQAJJQHEOCCGP-UHFFFAOYSA-N |
| XLogP | 10.78 |
| TPSA | 117.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.96 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|