C21H22N3O2+ — CID 7043455
[(1S)-2-(3-methoxyanilino)-2-oxo-1-phenylethyl]-(pyridin-2-ylmethyl)azanium (PubChem CID 7043455) has the molecular formula C21H22N3O2+ and a molecular weight of 348.43 g/mol. Its IUPAC name is [(1S)-2-(3-methoxyanilino)-2-oxo-1-phenylethyl]-(pyridin-2-ylmethyl)azanium.
| Compound Name | [(1S)-2-(3-methoxyanilino)-2-oxo-1-phenylethyl]-(pyridin-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 7043455 |
| Molecular Formula | C21H22N3O2+ |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | [(1S)-2-(3-methoxyanilino)-2-oxo-1-phenylethyl]-(pyridin-2-ylmethyl)azanium |
| SMILES | COc1cccc(NC(=O)[C@@H]([NH2+]Cc2ccccn2)c2ccccc2)c1 |
| InChI | InChI=1S/C21H21N3O2/c1-26-19-12-7-11-17(14-19)24-21(25)20(16-8-3-2-4-9-16)23-15-18-10-5-6-13-22-18/h2-14,20,23H,15H2,1H3,(H,24,25)/p+1/t20-/m0/s1 |
| InChIKey | TULMJBWVWYJNCQ-FQEVSTJZSA-O |
| XLogP | 2.53 |
| TPSA | 67.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |