C16H19N4O2+ — CID 7928623
[(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl]-(pyridin-2-ylmethyl)azanium (PubChem CID 7928623) has the molecular formula C16H19N4O2+ and a molecular weight of 299.35 g/mol. Its IUPAC name is [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl]-(pyridin-2-ylmethyl)azanium.
| Compound Name | [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl]-(pyridin-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 7928623 |
| Molecular Formula | C16H19N4O2+ |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl]-(pyridin-2-ylmethyl)azanium |
| SMILES | CNC(=O)NC(=O)[C@H]([NH2+]Cc1ccccn1)c1ccccc1 |
| InChI | InChI=1S/C16H18N4O2/c1-17-16(22)20-15(21)14(12-7-3-2-4-8-12)19-11-13-9-5-6-10-18-13/h2-10,14,19H,11H2,1H3,(H2,17,20,21,22)/p+1/t14-/m1/s1 |
| InChIKey | GTQOLZPRGCTOBO-CQSZACIVSA-O |
| XLogP | 0.34 |
| TPSA | 87.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |