C16H24N3O2+ — CID 7509463
cyclohexyl-[(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl]azanium (PubChem CID 7509463) has the molecular formula C16H24N3O2+ and a molecular weight of 290.39 g/mol. Its IUPAC name is cyclohexyl-[(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl]azanium.
| Compound Name | cyclohexyl-[(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 7509463 |
| Molecular Formula | C16H24N3O2+ |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | cyclohexyl-[(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl]azanium |
| SMILES | CNC(=O)NC(=O)[C@H]([NH2+]C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C16H23N3O2/c1-17-16(21)19-15(20)14(12-8-4-2-5-9-12)18-13-10-6-3-7-11-13/h2,4-5,8-9,13-14,18H,3,6-7,10-11H2,1H3,(H2,17,19,20,21)/p+1/t14-/m1/s1 |
| InChIKey | DSTHATPYXSLEJU-CQSZACIVSA-O |
| XLogP | 1.08 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |