About (2-carbamoylphenyl) 2-[(3-bromophenyl)methoxy]acetate
(2-carbamoylphenyl) 2-[(3-bromophenyl)methoxy]acetate (PubChem CID 70435197) has the molecular formula C16H14BrNO4
and a molecular weight of 364.20 g/mol. Its IUPAC name is (2-carbamoylphenyl) 2-[(3-bromophenyl)methoxy]acetate.
Molecular Properties
| Compound Name | (2-carbamoylphenyl) 2-[(3-bromophenyl)methoxy]acetate |
| PubChem CID | 70435197 |
| Molecular Formula | C16H14BrNO4 |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | (2-carbamoylphenyl) 2-[(3-bromophenyl)methoxy]acetate |
| SMILES | NC(=O)c1ccccc1OC(=O)COCc1cccc(Br)c1 |
| InChI | InChI=1S/C16H14BrNO4/c17-12-5-3-4-11(8-12)9-21-10-15(19)22-14-7-2-1-6-13(14)16(18)20/h1-8H,9-10H2,(H2,18,20) |
| InChIKey | KPCJFBHPUGNDMN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-carbamoylphenyl) 2-[(3-bromophenyl)methoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-carbamoylphenyl) 2-[(3-bromophenyl)methoxy]acetate?
The IUPAC name of (2-carbamoylphenyl) 2-[(3-bromophenyl)methoxy]acetate (CID 70435197) is (2-carbamoylphenyl) 2-[(3-bromophenyl)methoxy]acetate.
What is the SMILES notation for (2-carbamoylphenyl) 2-[(3-bromophenyl)methoxy]acetate?
The canonical SMILES for (2-carbamoylphenyl) 2-[(3-bromophenyl)methoxy]acetate is NC(=O)c1ccccc1OC(=O)COCc1cccc(Br)c1.
What is the InChIKey of (2-carbamoylphenyl) 2-[(3-bromophenyl)methoxy]acetate?
The InChIKey is KPCJFBHPUGNDMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14BrNO4/c17-12-5-3-4-11(8-12)9-21-10-15(19)22-14-7-2-1-6-13(14)16(18)20/h1-8H,9-10H2,(H2,18,20).
What are the key properties of (2-carbamoylphenyl) 2-[(3-bromophenyl)methoxy]acetate?
(2-carbamoylphenyl) 2-[(3-bromophenyl)methoxy]acetate has a molecular weight of 364.20 g/mol, XLogP of 2.67, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-carbamoylphenyl) 2-[(3-bromophenyl)methoxy]acetate is sourced from PubChem (CID 70435197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).