C32H41N3O6 — CID 70436845
(2S)-2-[[(2S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carbonyl]-[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]-4-amino-2-benzyl-3-oxopentanoic acid (PubChem CID 70436845) has the molecular formula C32H41N3O6 and a molecular weight of 563.70 g/mol. Its IUPAC name is (2S)-2-[[(2S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carbonyl]-[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]-4-amino-2-benzyl-3-oxopentanoic acid.
| Compound Name | (2S)-2-[[(2S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carbonyl]-[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]-4-amino-2-benzyl-3-oxopentanoic acid |
|---|---|
| PubChem CID | 70436845 |
| Molecular Formula | C32H41N3O6 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.30 |
| IUPAC Name | (2S)-2-[[(2S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carbonyl]-[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]-4-amino-2-benzyl-3-oxopentanoic acid |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N(C(=O)[C@@H]1C[C@@H]2CCC[C@@H]2N1)[C@](Cc1ccccc1)(C(=O)O)C(=O)C(C)N |
| InChI | InChI=1S/C32H41N3O6/c1-3-41-30(38)27(18-17-22-11-6-4-7-12-22)35(29(37)26-19-24-15-10-16-25(24)34-26)32(31(39)40,28(36)21(2)33)20-23-13-8-5-9-14-23/h4-9,11-14,21,24-27,34H,3,10,15-20,33H2,1-2H3,(H,39,40)/t21?,24-,25-,26-,27-,32-/m0/s1 |
| InChIKey | DJKSRVAUQMVQCZ-CSYRMVOASA-N |
| XLogP | 2.89 |
| TPSA | 139.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|