C35H38Cl2N8O5 — CID 70437470
4-[4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-(2-hydroxybutyl)-1,2,4-triazol-3-one (PubChem CID 70437470) has the molecular formula C35H38Cl2N8O5 and a molecular weight of 721.65 g/mol. Its IUPAC name is 4-[4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-(2-hydroxybutyl)-1,2,4-triazol-3-one.
| Compound Name | 4-[4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-(2-hydroxybutyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 70437470 |
| Molecular Formula | C35H38Cl2N8O5 |
| Molecular Weight | 721.65 g/mol |
| Exact Mass | 720.23 |
| IUPAC Name | 4-[4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-(2-hydroxybutyl)-1,2,4-triazol-3-one |
| SMILES | CCC(O)Cn1ncn(-c2ccc(N3CCN(c4ccc(OCC5COC(Cn6cncn6)(c6ccc(Cl)cc6Cl)O5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C35H38Cl2N8O5/c1-2-29(46)18-45-34(47)44(24-40-45)28-6-4-26(5-7-28)41-13-15-42(16-14-41)27-8-10-30(11-9-27)48-19-31-20-49-35(50-31,21-43-23-38-22-39-43)32-12-3-25(36)17-33(32)37/h3-12,17,22-24,29,31,46H,2,13-16,18-21H2,1H3 |
| InChIKey | UKJZMCFBGNILMY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.65 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|