C20H24FN3O4 — CID 70438392
8-cyclopropyl-6-fluoro-7-[3-[(2-hydroxyethylamino)methyl]pyrrolidin-1-yl]-4-oxo-1H-quinoline-3-carboxylic acid (PubChem CID 70438392) has the molecular formula C20H24FN3O4 and a molecular weight of 389.43 g/mol. Its IUPAC name is 8-cyclopropyl-6-fluoro-7-[3-[(2-hydroxyethylamino)methyl]pyrrolidin-1-yl]-4-oxo-1H-quinoline-3-carboxylic acid.
| Compound Name | 8-cyclopropyl-6-fluoro-7-[3-[(2-hydroxyethylamino)methyl]pyrrolidin-1-yl]-4-oxo-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 70438392 |
| Molecular Formula | C20H24FN3O4 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 8-cyclopropyl-6-fluoro-7-[3-[(2-hydroxyethylamino)methyl]pyrrolidin-1-yl]-4-oxo-1H-quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1c[nH]c2c(C3CC3)c(N3CCC(CNCCO)C3)c(F)cc2c1=O |
| InChI | InChI=1S/C20H24FN3O4/c21-15-7-13-17(23-9-14(19(13)26)20(27)28)16(12-1-2-12)18(15)24-5-3-11(10-24)8-22-4-6-25/h7,9,11-12,22,25H,1-6,8,10H2,(H,23,26)(H,27,28) |
| InChIKey | UESJQAGEFRCXSA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|