C25H33Cl2N3O5S — CID 70439982
[4-cyano-1-[2-(3,4-dichlorophenyl)ethyl-methylamino]-4-(3,4-dimethoxyphenyl)-5-methylhexyl]sulfamic acid (PubChem CID 70439982) has the molecular formula C25H33Cl2N3O5S and a molecular weight of 558.53 g/mol. Its IUPAC name is [4-cyano-1-[2-(3,4-dichlorophenyl)ethyl-methylamino]-4-(3,4-dimethoxyphenyl)-5-methylhexyl]sulfamic acid.
| Compound Name | [4-cyano-1-[2-(3,4-dichlorophenyl)ethyl-methylamino]-4-(3,4-dimethoxyphenyl)-5-methylhexyl]sulfamic acid |
|---|---|
| PubChem CID | 70439982 |
| Molecular Formula | C25H33Cl2N3O5S |
| Molecular Weight | 558.53 g/mol |
| Exact Mass | 557.15 |
| IUPAC Name | [4-cyano-1-[2-(3,4-dichlorophenyl)ethyl-methylamino]-4-(3,4-dimethoxyphenyl)-5-methylhexyl]sulfamic acid |
| SMILES | COc1ccc(C(C#N)(CCC(NS(=O)(=O)O)N(C)CCc2ccc(Cl)c(Cl)c2)C(C)C)cc1OC |
| InChI | InChI=1S/C25H33Cl2N3O5S/c1-17(2)25(16-28,19-7-9-22(34-4)23(15-19)35-5)12-10-24(29-36(31,32)33)30(3)13-11-18-6-8-20(26)21(27)14-18/h6-9,14-15,17,24,29H,10-13H2,1-5H3,(H,31,32,33) |
| InChIKey | JPWQJHMLWHTAJA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|