C19H20F3N3O3 — CID 70440373
ethyl 2-cyclopropyl-5,6,8-trifluoro-4-oxo-7-piperazin-1-yl-1H-quinoline-3-carboxylate (PubChem CID 70440373) has the molecular formula C19H20F3N3O3 and a molecular weight of 395.38 g/mol. Its IUPAC name is ethyl 2-cyclopropyl-5,6,8-trifluoro-4-oxo-7-piperazin-1-yl-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 2-cyclopropyl-5,6,8-trifluoro-4-oxo-7-piperazin-1-yl-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 70440373 |
| Molecular Formula | C19H20F3N3O3 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | ethyl 2-cyclopropyl-5,6,8-trifluoro-4-oxo-7-piperazin-1-yl-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(C2CC2)[nH]c2c(F)c(N3CCNCC3)c(F)c(F)c2c1=O |
| InChI | InChI=1S/C19H20F3N3O3/c1-2-28-19(27)11-15(9-3-4-9)24-16-10(18(11)26)12(20)13(21)17(14(16)22)25-7-5-23-6-8-25/h9,23H,2-8H2,1H3,(H,24,26) |
| InChIKey | FGMAURLBEJWXCG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|