C24H36N2O — CID 70441655
4-heptan-2-yl-2-(4-heptoxyphenyl)pyrimidine (PubChem CID 70441655) has the molecular formula C24H36N2O and a molecular weight of 368.57 g/mol. Its IUPAC name is 4-heptan-2-yl-2-(4-heptoxyphenyl)pyrimidine.
| Compound Name | 4-heptan-2-yl-2-(4-heptoxyphenyl)pyrimidine |
|---|---|
| PubChem CID | 70441655 |
| Molecular Formula | C24H36N2O |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | 4-heptan-2-yl-2-(4-heptoxyphenyl)pyrimidine |
| SMILES | CCCCCCCOc1ccc(-c2nccc(C(C)CCCCC)n2)cc1 |
| InChI | InChI=1S/C24H36N2O/c1-4-6-8-9-11-19-27-22-15-13-21(14-16-22)24-25-18-17-23(26-24)20(3)12-10-7-5-2/h13-18,20H,4-12,19H2,1-3H3 |
| InChIKey | IEPXXUYSCHHIKT-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|