C32H47FN2O2 — CID 56633439
[4-[4-(4-decan-2-ylpyrimidin-2-yl)phenyl]cyclohexyl] (2S,3S)-2-fluoro-3-methylpentanoate (PubChem CID 56633439) has the molecular formula C32H47FN2O2 and a molecular weight of 510.74 g/mol. Its IUPAC name is [4-[4-(4-decan-2-ylpyrimidin-2-yl)phenyl]cyclohexyl] (2S,3S)-2-fluoro-3-methylpentanoate.
| Compound Name | [4-[4-(4-decan-2-ylpyrimidin-2-yl)phenyl]cyclohexyl] (2S,3S)-2-fluoro-3-methylpentanoate |
|---|---|
| PubChem CID | 56633439 |
| Molecular Formula | C32H47FN2O2 |
| Molecular Weight | 510.74 g/mol |
| Exact Mass | 510.36 |
| IUPAC Name | [4-[4-(4-decan-2-ylpyrimidin-2-yl)phenyl]cyclohexyl] (2S,3S)-2-fluoro-3-methylpentanoate |
| SMILES | CCCCCCCCC(C)c1ccnc(-c2ccc(C3CCC(OC(=O)[C@@H](F)[C@@H](C)CC)CC3)cc2)n1 |
| InChI | InChI=1S/C32H47FN2O2/c1-5-7-8-9-10-11-12-24(4)29-21-22-34-31(35-29)27-15-13-25(14-16-27)26-17-19-28(20-18-26)37-32(36)30(33)23(3)6-2/h13-16,21-24,26,28,30H,5-12,17-20H2,1-4H3/t23-,24?,26?,28?,30-/m0/s1 |
| InChIKey | UQKPINHNAHVBTA-FOJLVNCGSA-N |
| XLogP | 8.95 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.74 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|