C26H38ClNO3 — CID 70445557
2-[2-[3-(3,4-dimethoxyphenyl)propylamino]ethyl]-1-propan-2-yl-3,4-dihydro-1H-naphthalen-2-ol;hydrochloride (PubChem CID 70445557) has the molecular formula C26H38ClNO3 and a molecular weight of 448.05 g/mol. Its IUPAC name is 2-[2-[3-(3,4-dimethoxyphenyl)propylamino]ethyl]-1-propan-2-yl-3,4-dihydro-1H-naphthalen-2-ol;hydrochloride.
| Compound Name | 2-[2-[3-(3,4-dimethoxyphenyl)propylamino]ethyl]-1-propan-2-yl-3,4-dihydro-1H-naphthalen-2-ol;hydrochloride |
|---|---|
| PubChem CID | 70445557 |
| Molecular Formula | C26H38ClNO3 |
| Molecular Weight | 448.05 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 2-[2-[3-(3,4-dimethoxyphenyl)propylamino]ethyl]-1-propan-2-yl-3,4-dihydro-1H-naphthalen-2-ol;hydrochloride |
| SMILES | COc1ccc(CCCNCCC2(O)CCc3ccccc3C2C(C)C)cc1OC.Cl |
| InChI | InChI=1S/C26H37NO3.ClH/c1-19(2)25-22-10-6-5-9-21(22)13-14-26(25,28)15-17-27-16-7-8-20-11-12-23(29-3)24(18-20)30-4;/h5-6,9-12,18-19,25,27-28H,7-8,13-17H2,1-4H3;1H |
| InChIKey | GYNAESNRBPEWAU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.05 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|